CAS 355-28-2

1H,1H-Nonafluoropentan-1-ol

Description:

1H,1H-Nonafluoropentan-1-ol, with the CAS number 355-28-2, is a fluorinated alcohol characterized by the presence of a long carbon chain and multiple fluorine atoms. This compound features a pentanol backbone, where the hydroxyl (-OH) group is attached to the first carbon, and all other hydrogen atoms are replaced by fluorine atoms, resulting in a highly fluorinated structure. The presence of fluorine atoms imparts unique properties, such as increased hydrophobicity and thermal stability, making it less soluble in water compared to non-fluorinated alcohols. Additionally, the compound exhibits low volatility and high chemical resistance, which can be advantageous in various applications, including as a surfactant or in specialty coatings. Its fluorinated nature also raises environmental and health considerations, as perfluorinated compounds are known for their persistence in the environment. Overall, 1H,1H-Nonafluoropentan-1-ol is notable for its unique chemical properties stemming from its fluorinated structure.

Formula: C₅H₃F₉O

InChI: InChI=1/C5H3F9O/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14/h15H,1H2

SMILES: C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O

Synonyms:

• 2,2,3,3,4,4,5,5,5-Nonafluoropentan-1-Ol

1H,1H-Perfluoropentan-1-ol

CAS: 355-28-2

Formula: C₅H₃F₉O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 250.0623

Ref: IN-DA003ED7

1H,1H-Nonafluoro-1-pentanol

CAS: 355-28-2

Formula: C₅H₃F₉O

Purity: >97.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 250.06

Ref: 3B-N0810

1H,1H-Nonafluoropentan-1-ol

CAS: 355-28-2

1H,1H-Nonafluoropentan-1-ol

Formula: C₅H₃F₉O

Purity: 97%

Color and Shape: clear liquid

Molecular weight: 250.06g/mol

Ref: 54-PC6186

1H,1H-Perfluoropentan-1-ol

CAS: 355-28-2

Formula: C₅H₃F₉O

Purity: 97.0%

Color and Shape: Clear

Molecular weight: 250.064

Ref: 10-F007150