CAS 355-36-2
:1H-6-bromoperfluorohexane
Description:
1H-6-bromoperfluorohexane, with the CAS number 355-36-2, is a perfluorinated compound characterized by the presence of a bromine atom attached to a fully fluorinated hexane chain. This compound is part of a larger class of perfluoroalkyl substances (PFAS), which are known for their unique chemical properties, including high thermal and chemical stability, low surface tension, and resistance to degradation. The presence of the bromine atom introduces a halogen that can influence the compound's reactivity and potential applications. Typically, perfluorinated compounds exhibit low solubility in water and high solubility in organic solvents, making them useful in various industrial applications, including surfactants and coatings. However, due to environmental and health concerns associated with PFAS, including bioaccumulation and potential toxicity, the use and regulation of such compounds are increasingly scrutinized. Safety data sheets and regulatory guidelines should be consulted for handling and disposal practices.
Formula:C6HBrF12
InChI:InChI=1/C6HBrF12/c7-6(18,19)5(16,17)4(14,15)3(12,13)2(10,11)1(8)9/h1H
SMILES:C(C(C(C(C(C(Br)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 6H-Perfluorohexyl bromide
- F0633 s. dort 1H,6-Bromoperfluorohexane [6H-Perfluorohexylbromide]
- F01633 s. dort 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluor
- 1-Bromo-1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
