CAS 355-68-0
:Perfluorocyclohexane
Description:
Perfluorocyclohexane, with the CAS number 355-68-0, is a fully fluorinated cyclic hydrocarbon. It is characterized by a stable structure where all hydrogen atoms of cyclohexane are replaced by fluorine atoms, resulting in a highly non-polar and hydrophobic compound. This substance is colorless, odorless, and exhibits low volatility, making it useful in various applications, including as a solvent and in specialty chemical processes. Its chemical stability is notable, as it is resistant to thermal degradation and does not readily react with most chemicals, including strong acids and bases. Perfluorocyclohexane has a high dielectric constant, which makes it suitable for use in electronic applications. Additionally, it is considered environmentally persistent due to its resistance to degradation, raising concerns about its potential ecological impact. Safety data indicates that while it is generally considered to have low toxicity, proper handling and disposal practices are essential to mitigate any risks associated with exposure.
Formula:C6F12
InChI:InChI=1S/C6F12/c7-1(8)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12
InChI key:InChIKey=RKIMETXDACNTIE-UHFFFAOYSA-N
SMILES:FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
Synonyms:- 1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorocyclohexane
- Cyclohexane, 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-
- Cyclohexane, dodecafluoro-
- Dodecafluorocyclohexane
- FC-c 51-12c
- NSC 68382
- Perfluorocyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.