CAS 355012-88-3
:(3R,4R)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol hydrochloride
Description:
(3R,4R)-1-butyl-2-(hydroxymethyl)piperidine-3,4,5-triol hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features multiple hydroxyl (-OH) groups, indicating it is a polyol, which contributes to its hydrophilicity and potential for forming hydrogen bonds. The presence of a butyl group enhances its lipophilicity, which may influence its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit various pharmacological properties, potentially acting as a chiral building block in medicinal chemistry or as a precursor in the synthesis of more complex molecules. Its stereochemistry, indicated by the (3R,4R) configuration, suggests specific spatial arrangements that can significantly affect its biological interactions and efficacy. Overall, this compound's unique structural features make it of interest in both research and pharmaceutical applications.
Formula:C10H22ClNO4
InChI:InChI=1/C10H21NO4.ClH/c1-2-3-4-11-5-8(13)10(15)9(14)7(11)6-12;/h7-10,12-15H,2-6H2,1H3;1H/t7?,8?,9-,10-;/m1./s1
SMILES:CCCCN1CC([C@H]([C@@H](C1CO)O)O)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Butyldeoxymannojirimycin Hydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications An extremely potent and selective a-D-mannosidase inhibitor.Formula:C10H21NO4·ClHColor and Shape:NeatMolecular weight:255.74
