CAS 355012-89-4
:Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2,3-dioxo-, hydrate (1:1), (1S,4S)-
Description:
Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2,3-dioxo-, hydrate (1:1), (1S,4S)- is a complex organic compound characterized by its bicyclic structure, which consists of a heptane framework with additional functional groups. The presence of a methanesulfonic acid moiety indicates that it possesses acidic properties, making it potentially useful in various chemical reactions, particularly in organic synthesis and catalysis. The 7,7-dimethyl-2,3-dioxo substituents suggest that the compound may exhibit significant reactivity due to the presence of carbonyl groups, which can participate in nucleophilic addition reactions. The (1S,4S) stereochemistry indicates specific spatial arrangements of the substituents, which can influence the compound's reactivity and interactions with other molecules. As a hydrate, it contains water molecules in its structure, which can affect its solubility and stability. Overall, this compound's unique structural features and functional groups make it of interest in the fields of organic chemistry and materials science.
Formula:C10H14O5S·H2O
InChI:InChI=1S/C10H14O5S.H2O/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11;/h6H,3-5H2,1-2H3,(H,13,14,15);1H2/t6-,10-;/m1./s1
InChI key:InChIKey=YEGBEDZBQAKLIO-MIWKYWLESA-N
SMILES:C(S(=O)(=O)O)[C@@]12[C@](C)(C)[C@@](C(=O)C1=O)(CC2)[H].O
Synonyms:- Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2,3-dioxo-, monohydrate, (1S,4S)-
- Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2,3-dioxo-, hydrate (1:1), (1S,4S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Camphorquinone-10-sulfonic acid hydrate
CAS:<p>Camphorquinone-10-sulfonic acid hydrate is a soybean trypsin inhibitor that is used as a preparative agent in organic synthesis. It reacts with histidine, lysine residues, and other molecules to form a light-chain kinase that inhibits the action of the enzyme trypsin. Camphorquinone-10-sulfonic acid hydrate has been shown to be resistant to proteolysis by gastrointestinal enzymes. This agent also has diabetogenic properties by inhibiting the activity of membrane potential and chloride channels in pancreatic β cells. Camphorquinone-10-sulfonic acid hydrate forms an ion pair with choline, which can inhibit the enzyme acetylcholinesterase, leading to accumulation of acetylcholine at nerve endings.</p>Formula:C10H16O6SPurity:Min. 95 Area-%Color and Shape:Yellow PowderMolecular weight:264.3 g/mol
