CAS 35517-14-7
:N-(6-Aminohexyl)-2-Naphthalenesulfonamide, Hydrochloride
Description:
N-(6-Aminohexyl)-2-naphthalenesulfonamide hydrochloride, with the CAS number 35517-14-7, is a chemical compound characterized by its sulfonamide functional group and a naphthalene moiety. This compound typically appears as a white to off-white solid and is soluble in water, which is a common trait for many sulfonamides due to the presence of the sulfonic acid group. The presence of the aminohexyl chain enhances its solubility and may contribute to its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its hydrochloride form indicates that it is a salt, which can influence its stability and solubility properties. As with many sulfonamides, it may exhibit antibacterial properties, although specific biological activities would depend on further research and context. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C16H23ClN2O2S
InChI:InChI=1/C16H22N2O2S.ClH/c17-11-5-1-2-6-12-18-21(19,20)16-10-9-14-7-3-4-8-15(14)13-16;/h3-4,7-10,13,18H,1-2,5-6,11-12,17H2;1H
SMILES:C(CCCNS(=O)(=O)c1ccc2ccccc2c1)CCN.Cl
Synonyms:- 6-[(Naphthalen-2-Ylsulfonyl)Amino]Hexan-1-Aminium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(6-Aminohex-1-yl)naphthalene-2-sulphonamide hydrochloride
CAS:<p>N-(6-Aminohex-1-yl)naphthalene-2-sulphonamide hydrochloride</p>Formula:C16H22N2O2S·ClHPurity:≥95%Color and Shape: pale beige solidMolecular weight:342.88g/molN-(6-Aminohexyl)-2-naphthalenesulfonamide Hydrochloride
CAS:Controlled Product<p>Applications N-(6-Aminohexyl)-2-naphthalenesulfonamide Hydrochloride is a calmodulin antagonist that binds calmodulin and inhibits calcium ion calmodulin-regulated activities such as phosphodiesterase activation and myosin light chain kinase (1, 2).<br>References (1) Hidaka, H., et al.: Tanpakushitsu Kakusan Koso. (1981) 26, 977-93 (2) Lazzaro, M., et al.: Planta (2013) 238, 587-597<br></p>Formula:C16H22N2O2S·ClHColor and Shape:NeatMolecular weight:342.88

