
CAS 35518-76-4
:2-Ethylundecanal
Description:
2-Ethylundecanal is an organic compound classified as an aldehyde, characterized by its long carbon chain and the presence of a terminal carbonyl group. With the molecular formula C13H26O, it features a straight-chain structure with an ethyl group attached to the second carbon of an undecanal backbone. This compound is typically a colorless to pale yellow liquid with a distinctive fatty, waxy odor, which can be appealing in fragrance applications. Its boiling point is relatively high due to the length of the carbon chain, and it is soluble in organic solvents while being less soluble in water. 2-Ethylundecanal is often used in the synthesis of various chemical products, including fragrances and flavoring agents, due to its pleasant aroma. Additionally, it may exhibit properties such as being a potential intermediate in organic synthesis and having applications in the cosmetic and food industries. Safety data indicates that, like many aldehydes, it should be handled with care due to potential irritant effects.
Formula:C13H26O
InChI:InChI=1S/C13H26O/c1-3-5-6-7-8-9-10-11-13(4-2)12-14/h12-13H,3-11H2,1-2H3
InChI key:InChIKey=PPJRQOPBVSCJCN-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)(CC)C=O
Synonyms:- 2-Ethylundecanal
- Undecanal, 2-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Ethylundecanal
CAS:<p>2-Ethylundecanal is a biochemical.</p>Formula:C13H26OColor and Shape:SolidMolecular weight:198.34
