CAS 35520-81-1

methyl bicyclo[2.2.1]heptane-2-carboxylate

Description:

Methyl bicyclo[2.2.1]heptane-2-carboxylate is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework with a carboxylate ester functional group. This compound features a methyl ester group attached to the carboxylic acid, contributing to its reactivity and solubility properties. The bicyclic structure imparts unique steric and electronic characteristics, making it interesting for various chemical reactions, including esterification and nucleophilic substitutions. Methyl bicyclo[2.2.1]heptane-2-carboxylate is typically a colorless to pale yellow liquid with a pleasant odor, and it may exhibit moderate volatility. Its chemical behavior can be influenced by the presence of the bicyclic system, which can affect the compound's stability and reactivity. This compound is often used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₄O₂

InChI: InChI=1/C9H14O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h6-8H,2-5H2,1H3

SMILES: COC(=O)C1CC2CCC1C2

Synonyms:

• Bicyclo[2.2.1]heptane-2-carboxylic acid, methyl ester

Methyl bicyclo[2.2.1]heptane-2-carboxylate

CAS: 35520-81-1

Versatile small molecule scaffold

Formula: C₉H₁₄O₂

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-KBA52081