CAS 35522-89-5
:1,2-O-(1-methylethylidene)-alpha-D-xylofuranuronic acid
Description:
1,2-O-(1-methylethylidene)-alpha-D-xylofuranuronic acid, with the CAS number 35522-89-5, is a chemical compound that belongs to the class of uronic acids, which are derived from sugars. This substance features a furanose ring structure, indicative of its five-membered cyclic form, and contains a methylethylidene group that contributes to its unique reactivity and stability. The presence of the uronic acid functional group suggests that it may participate in various biochemical processes, particularly in polysaccharide biosynthesis and metabolism. Its stereochemistry, denoted by the alpha configuration, implies specific spatial arrangements of its hydroxyl groups, which can influence its interactions with enzymes and other biomolecules. This compound may exhibit solubility in polar solvents due to its hydroxyl groups, and its potential applications could span fields such as biochemistry, pharmaceuticals, and materials science, particularly in the development of glycosylated compounds or as a building block in carbohydrate chemistry. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C8H12O6
InChI:InChI=1/C8H12O6/c1-8(2)13-5-3(9)4(6(10)11)12-7(5)14-8/h3-5,7,9H,1-2H3,(H,10,11)/t3-,4-,5+,7+/m0/s1
Synonyms:- 1,2-O-(1-Methylethylidene)-alpha-D-xylofuranuronic acid
- 1,2-O-Isopropylidene-a-D-xylofuranuronic acid
- (3aS,5R,6S,6aS)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2-O-Isopropylidene-a-D-xylofuranuronic acid
CAS:<p>1,2-O-Isopropylidene-a-D-xylofuranuronic acid is a methylated form of the sugar xylofuranose. It is also known as 1,2-di-O-methylxylofuranuronic acid. The compound belongs to the class of oligosaccharides and polysaccharides. It has CAS number 35522-89-5 and molecular weight of 206.24 g/mol. It is soluble in water and ethanol but insoluble in ether. It can be used for chemical synthesis and modification of saccharide chains.</p>Formula:C8H12O6Purity:Min. 95%Molecular weight:204.18 g/mol
