CAS 355382-19-3

N-(pyridin-2-ylmethyl)tricyclo[3.3.1.1~3,7~]decan-1-amine

Description:

N-(pyridin-2-ylmethyl)tricyclo[3.3.1.1^3,7]decan-1-amine is a chemical compound characterized by its complex tricyclic structure, which includes a decane backbone fused with three cycloalkane rings. The presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributes to its unique chemical properties, including potential interactions with biological systems. This compound features an amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The specific arrangement of atoms and functional groups in this molecule may impart specific pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 355382-19-3, allows for precise identification in chemical databases. Overall, the structural complexity and functional groups of N-(pyridin-2-ylmethyl)tricyclo[3.3.1.1^3,7]decan-1-amine suggest potential applications in drug development and materials science, although further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₆H₂₂N₂

InChI: InChI=1/C16H22N2/c1-2-4-17-15(3-1)11-18-16-8-12-5-13(9-16)7-14(6-12)10-16/h1-4,12-14,18H,5-11H2

SMILES: c1ccnc(c1)CNC12CC3CC(CC(C3)C2)C1

N-(2-pyridinylmethyl)-1-adamantanamine hydrobromide

CAS: 355382-19-3

Purity: 95.0%

Molecular weight: 323.27801513671875

Ref: 10-F361278