CAS 35542-01-9
:5-Methoxyuridine
Description:
5-Methoxyuridine is a nucleoside analog of uridine, characterized by the presence of a methoxy group at the 5-position of the uracil base. This modification influences its biochemical properties and interactions. It is typically represented by the molecular formula C10H13N2O5 and has a molecular weight that reflects its structure. 5-Methoxyuridine is soluble in water and exhibits polar characteristics due to its hydroxyl and methoxy groups. This compound is of interest in biochemical research, particularly in studies related to RNA synthesis and antiviral activity, as it can be incorporated into RNA strands, potentially affecting their function. Additionally, it has been investigated for its potential therapeutic applications, including its role in modulating cellular processes. As with many nucleoside analogs, its activity may depend on the specific cellular context and the presence of enzymes that can phosphorylate it to its active triphosphate form. Overall, 5-Methoxyuridine serves as a valuable tool in molecular biology and pharmacology.
Formula:C10H14N2O7
InChI:InChI=1S/C10H14N2O7/c1-18-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)19-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1
InChI key:InChIKey=ZXIATBNUWJBBGT-JXOAFFINSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C=C(OC)C(=O)NC2=O
Synonyms:- Uridine, 5-methoxy-
- 5-Methoxyuridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Methoxyuridine
CAS:Formula:C10H14N2O7Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white powderMolecular weight:274.235-Methoxyuridine
CAS:<p>5-Methoxyuridine (Mo5U) is an antitumor purine analog that inhibits DNA synthesis and induces apoptosis in lymphatic cancers.</p>Formula:C10H14N2O7Purity:99.43%Color and Shape:SolidMolecular weight:274.235-Methoxyuridine
CAS:<p>5-Methoxyuridine is a nucleoside that is structurally related to uridine. It is an intermediate in the biosynthesis of pyrimidines and is also used as a precursor for other compounds. 5-Methoxyuridine has been shown to inhibit protein synthesis by binding to purine receptors and inhibiting the function of protein kinases. The x-ray crystal structures of 5-methoxyuridine bound to two different p2y receptors have been determined. The analytical chemistry of 5-methoxyuridine is based on UV absorption measurements, which are able to identify hydrogen bonds between the base and the sugar moiety. This drug has been investigated for its potential use in cancer therapy due to its ability to inhibit RNA synthesis, which can lead to cell death by incomplete replication or transcription. 5-Methoxyuridine inhibits messenger RNA (mRNA) production in bacteria by interfering with sequence recognition and binding sites within the ribosome and preventing</p>Formula:C10H14N2O7Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:274.23 g/mol1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-methoxypyrimidine-2,4(1H,3H)-dione
CAS:Formula:C10H14N2O7Purity:97%Molecular weight:274.229
