CAS 35558-46-4
:2,2',9,9',10,10'-hexamethoxy-2,2',3,3',4,4',4a,4a',5,5',6,6',8,8a,9,9',10,11,12,12a,13,13a,13b,13b'-tetracosahydro-1H,1'H-4,4'-biisoquino[3,2-a]isoquinoline-3,3'-diol
Description:
2,2',9,9',10,10'-hexamethoxy-2,2',3,3',4,4',4a,4a',5,5',6,6',8,8a,9,9',10,11,12,12a,13,13a,13b,13b'-tetracosahydro-1H,1'H-4,4'-biisoquino[3,2-a]isoquinoline-3,3'-diol, with CAS number 35558-46-4, is a complex organic compound characterized by its extensive polycyclic structure and multiple methoxy substituents. This compound features a unique arrangement of isoquinoline units, contributing to its potential biological activity and chemical reactivity. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its interaction with biological systems. Its intricate structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, due to its complexity, detailed studies on its physical properties, such as melting point, solubility, and spectral characteristics, are essential for understanding its behavior in various chemical environments. As with many synthetic organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C40H60N2O8
InChI:InChI=1/C40H60N2O8/c1-45-31-9-7-21-15-29-25-17-33(47-3)37(43)35(23(25)11-13-41(29)19-27(21)39(31)49-5)36-24-12-14-42-20-28-22(8-10-32(46-2)40(28)50-6)16-30(42)26(24)18-34(48-4)38(36)44/h7,9,15,19,22-26,28,30,32-40,43-44H,8,10-14,16-18,20H2,1-6H3
SMILES:COC1=CC=c2cc3C4CC(C(C(C4CCn3cc2C1OC)C1C2CCN3CC4C(CCC(C4OC)OC)CC3C2CC(C1O)OC)O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
