
CAS 3558-28-9
:1,3-Dimethyl-2-phenyl-1H-indole
Description:
1,3-Dimethyl-2-phenyl-1H-indole, with the CAS number 3558-28-9, is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features two methyl groups attached to the nitrogen-containing indole ring and a phenyl group at the 2-position, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of solubility in organic solvents, depending on the specific conditions. The presence of the dimethyl and phenyl substituents can influence its reactivity, making it of interest in various chemical synthesis and medicinal chemistry applications. Additionally, compounds of this class may exhibit biological activity, which has led to research into their potential pharmacological effects. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C16H15N
InChI:InChI=1S/C16H15N/c1-12-14-10-6-7-11-15(14)17(2)16(12)13-8-4-3-5-9-13/h3-11H,1-2H3
InChI key:InChIKey=CINHHVCRUDHEHC-UHFFFAOYSA-N
SMILES:CC1=C(N(C)C=2C1=CC=CC2)C3=CC=CC=C3
Synonyms:- 1,3-Dimethyl-2-phenyl-1H-indole
- Indole, 1,3-dimethyl-2-phenyl-
- 1H-Indole, 1,3-dimethyl-2-phenyl-
- N,3-Dimethyl-2-phenylindole
- 1,3-Dimethyl-2-phenylindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.