CymitQuimica logo

CAS 355803-75-7

:

N,N-dimethyl-2-methylsulfonylsulfanyl-ethanamine hydrochloride

Description:
N,N-Dimethyl-2-methylsulfonylsulfanyl-ethanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a dimethylamino group and a methylsulfonylsulfanyl moiety. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the hydrochloride salt form suggests enhanced stability and solubility in aqueous environments, making it suitable for various applications in pharmaceutical and biochemical research. Its molecular structure contributes to its potential biological activity, which may include interactions with neurotransmitter systems or other biological pathways. As with many chemical substances, safety data should be consulted, as it may pose risks such as irritation or toxicity depending on exposure levels. Proper handling and storage conditions are essential to ensure safety and maintain the integrity of the compound.
Formula:C5H14ClNO2S2
InChI:InChI=1/C5H13NO2S2.ClH/c1-6(2)4-5-9-10(3,7)8;/h4-5H2,1-3H3;1H
SMILES:CN(C)CCSS(=O)(=O)C.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.