CAS 355803-78-0
:Ethyl 3-[(3-pentyl-2-oxiranyl)methyl]-2-oxiranedecanoate
Description:
Ethyl 3-[(3-pentyl-2-oxiranyl)methyl]-2-oxiranedecanoate, with the CAS number 355803-78-0, is a synthetic organic compound characterized by its unique structure that includes both ethyl and oxirane (epoxide) functional groups. This compound features a long carbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the oxirane rings indicates potential reactivity, particularly in nucleophilic addition reactions, which can be exploited in various chemical syntheses. Additionally, the pentyl group enhances the compound's lipophilicity, potentially influencing its behavior in biological systems. Ethyl 3-[(3-pentyl-2-oxiranyl)methyl]-2-oxiranedecanoate may exhibit interesting physical properties, such as a specific boiling point and melting point, which are typical of larger organic molecules. Its applications could span fields such as materials science, pharmaceuticals, or agrochemicals, depending on its reactivity and stability under various conditions. However, specific safety and handling guidelines should be followed due to the presence of reactive oxirane groups.
Formula:C22H40O4
InChI:InChI=1S/C22H40O4/c1-3-5-11-14-18-20(25-18)17-21-19(26-21)15-12-9-7-6-8-10-13-16-22(23)24-4-2/h18-21H,3-17H2,1-2H3
InChI key:InChIKey=PEZIQWVKZYIKRH-UHFFFAOYSA-N
SMILES:C(C1C(CCCCCCCCCC(OCC)=O)O1)C2C(CCCCC)O2
Synonyms:- 2-Oxiranedecanoic acid, 3-[(3-pentyl-2-oxiranyl)methyl]-, ethyl ester
- Ethyl 3-[(3-pentyl-2-oxiranyl)methyl]-2-oxiranedecanoate
- Oxiranedecanoic acid, 3-[(3-pentyloxiranyl)methyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 11,14-Diepoxyeicosanoate
CAS:Controlled ProductApplications A standard used to determine epoxidized soybean oil in foods.
References Castle, L., et al.: J. Assoc. Off. Anal. Chem., 7, 6, 1183 (1988)Formula:C22H40O4Color and Shape:Light YellowMolecular weight:368.55
