CAS 35581-31-8

5-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid

Description:

5-(4-Nitrophenyl)-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) at the 4-position of the pyrazole contributes to its acidic properties, making it a potential candidate for various chemical reactions and applications. The 4-nitrophenyl substituent at the 5-position introduces an electron-withdrawing nitro group, which can enhance the compound's reactivity and influence its electronic properties. This compound is typically used in medicinal chemistry and research due to its potential biological activities, including anti-inflammatory and antimicrobial properties. Additionally, its structural features allow for further derivatization, making it a versatile building block in organic synthesis. The compound is usually handled with standard safety precautions, as with many organic chemicals, and its stability can be influenced by environmental factors such as pH and temperature.

Formula: C₁₀H₇N₃O₄

InChI: InChI=1/C10H7N3O4/c14-10(15)8-5-11-12-9(8)6-1-3-7(4-2-6)13(16)17/h1-5H,(H,11,12)(H,14,15)

SMILES: c1cc(ccc1c1c(c[nH]n1)C(=O)O)N(=O)=O

Synonyms:

• 3-(4-Nitrophenyl)-pyrazole-4-carboxylic acid

5-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid

CAS: 35581-31-8

Formula: C₁₀H₇N₃O₄

Purity: 95.0%

Molecular weight: 233.183

Ref: 10-F525979