CAS 355816-11-4
:N-[(3-Methoxyphenyl)methyl]-1,3-benzodioxole-5-methanamine
Description:
N-[(3-Methoxyphenyl)methyl]-1,3-benzodioxole-5-methanamine, identified by its CAS number 355816-11-4, is a chemical compound that features a complex structure characterized by the presence of a benzodioxole moiety and a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, which may influence its solubility, reactivity, and biological activity. The methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. The presence of the amine functional group suggests that it may engage in hydrogen bonding and participate in various chemical reactions, including alkylation and acylation. Additionally, compounds with similar structures are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. Overall, this compound represents a unique structure that may have interesting chemical and biological properties worthy of further exploration.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c1-18-14-4-2-3-12(7-14)9-17-10-13-5-6-15-16(8-13)20-11-19-15/h2-8,17H,9-11H2,1H3
InChI key:InChIKey=JGHIAUKWFDEKRG-UHFFFAOYSA-N
SMILES:C(NCC1=CC(OC)=CC=C1)C=2C=C3C(=CC2)OCO3
Synonyms:- (2H-1,3-Benzodioxol-5-ylmethyl)[(3-methoxyphenyl)methyl]amine
- 1,3-benzodioxole-5-methanamine, N-[(3-methoxyphenyl)methyl]-
- 1-(Benzo[d][1,3]dioxol-5-yl)-N-(3-methoxybenzyl)methanamine
- Benzo[1,3]dioxol-5-ylmethyl-(3-methoxy-benzyl)-amine
- N-[(3-Methoxyphenyl)methyl]-1,3-benzodioxole-5-methanamine
- [(2H-1,3-Benzodioxol-5-yl)methyl][(3-methoxyphenyl)methyl]amine
- 1-(1,3-Benzodioxol-5-yl)-n-(3-methoxybenzyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.