CAS 355817-34-4

N-(2,5-dimethoxybenzyl)cycloheptanamine

Description:

N-(2,5-dimethoxybenzyl)cycloheptanamine is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and a benzyl group substituted with two methoxy groups at the 2 and 5 positions. This compound belongs to the class of amines and is notable for its potential applications in medicinal chemistry, particularly in the development of psychoactive substances. The presence of the methoxy groups can influence the compound's lipophilicity, potentially affecting its pharmacokinetic properties, such as absorption and distribution in biological systems. Additionally, the cycloheptane ring contributes to the compound's three-dimensional conformation, which may play a crucial role in its interaction with biological targets. The compound's CAS number, 355817-34-4, allows for precise identification and retrieval of information in chemical databases. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions and the presence of other substances. Overall, N-(2,5-dimethoxybenzyl)cycloheptanamine represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₆H₂₅NO₂

InChI: InChI=1/C16H25NO2/c1-18-15-9-10-16(19-2)13(11-15)12-17-14-7-5-3-4-6-8-14/h9-11,14,17H,3-8,12H2,1-2H3

SMILES: COc1ccc(c(c1)CNC1CCCCCC1)OC

Synonyms:

• cycloheptanamine, N-[(2,5-dimethoxyphenyl)methyl]-
• Cycloheptyl-(2,5-dimethoxy-benzyl)-amine