CAS 35582-11-7

2-(3-methoxyphenyl)ethanethioamide

Description:

2-(3-Methoxyphenyl)ethanethioamide, with the CAS number 35582-11-7, is an organic compound characterized by its thioamide functional group and a methoxy-substituted phenyl ring. This compound features a two-carbon ethyl chain linking the thioamide group to the aromatic system, which contributes to its chemical reactivity and potential biological activity. The presence of the methoxy group enhances the lipophilicity of the molecule, potentially influencing its solubility and interaction with biological targets. Thioamides are known for their ability to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, the stability, reactivity, and biological activity of 2-(3-methoxyphenyl)ethanethioamide can be influenced by environmental factors such as pH and temperature.

Formula: C₉H₁₁NOS

InChI: InChI=1/C9H11NOS/c1-11-8-4-2-3-7(5-8)6-9(10)12/h2-5H,6H2,1H3,(H2,10,12)

SMILES: COc1cccc(c1)CC(=N)S

Synonyms:

• Benzeneethanethioamide, 3-Methoxy-

2-(3-Methoxyphenyl)thioacetamide

CAS: 35582-11-7

2-(3-Methoxyphenyl)thioacetamide

Purity: 95%

Molecular weight: 181.25g/mol

Ref: 54-OR346069