CAS 35588-36-4
:2-chloro-N-(2-methyl-5-nitrophenyl)acetamide
Description:
2-Chloro-N-(2-methyl-5-nitrophenyl)acetamide is an organic compound characterized by its amide functional group, which is linked to a chloro-substituted acetamide structure. This compound features a nitrophenyl moiety, specifically a 2-methyl-5-nitrophenyl group, indicating the presence of both a methyl group and a nitro group on the aromatic ring. The chlorine atom is attached to the acetamide portion, contributing to its reactivity and potential applications in various chemical reactions. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of electronegative atoms such as chlorine and nitrogen, which can influence their solubility in polar solvents. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. This substance may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as compounds with halogen and nitro groups can pose specific hazards.
Formula:C9H9ClN2O3
InChI:InChI=1/C9H9ClN2O3/c1-6-2-3-7(12(14)15)4-8(6)11-9(13)5-10/h2-4H,5H2,1H3,(H,11,13)
SMILES:Cc1ccc(cc1N=C(CCl)O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
