
CAS 35599-91-8
:(2,3-Dichlorophenyl)(hydroxy)acetic acid
Description:
(2,3-Dichlorophenyl)(hydroxy)acetic acid, with the CAS number 35599-91-8, is an organic compound characterized by its dichlorophenyl group and a hydroxyacetic acid moiety. This substance typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxy group, which enhances its hydrophilicity. The dichlorophenyl substituent contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique pharmacological properties. The compound may be used in various applications, including pharmaceuticals and agrochemicals, owing to its ability to interact with biological systems. Its chemical structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, (2,3-Dichlorophenyl)(hydroxy)acetic acid is a notable compound in organic chemistry with implications in medicinal and agricultural chemistry.
Formula:C8H6Cl2O3
InChI:InChI=1S/C8H6Cl2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13)
InChI key:InChIKey=BBKBVCLSUNDJCP-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(Cl)C(Cl)=CC=C1
Synonyms:- 2,3-Dichloromandelic acid
- 2,3-Dichloro-α-hydroxybenzeneacetic acid
- 2-(2,3-Dichlorophenyl)-2-hydroxyacetic acid
- Benzeneacetic acid, 2,3-dichloro-α-hydroxy-
- (2,3-Dichlorophenyl)(hydroxy)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
