CAS 356-28-5
:Ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate
Description:
Ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate, with the CAS number 356-28-5, is a fluorinated organic compound characterized by its unique structure that includes both an ethenyl group and a heptafluorobutanoate moiety. This compound is typically a colorless liquid at room temperature and exhibits a low boiling point, which is common among fluorinated compounds. Its molecular structure imparts significant chemical stability and resistance to degradation, making it useful in various applications, including as a reagent in organic synthesis and in the production of specialty chemicals. The presence of multiple fluorine atoms contributes to its hydrophobic nature and enhances its thermal and chemical stability. Additionally, this compound may exhibit unique properties such as low surface tension and high electronegativity, which can influence its reactivity and interactions with other substances. Safety considerations are essential when handling this compound, as fluorinated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards.
Formula:C6H3F7O2
InChI:InChI=1S/C6H3F7O2/c1-2-15-3(14)4(7,8)5(9,10)6(11,12)13/h2H,1H2
InChI key:InChIKey=CJABYGHRZGXUKQ-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(C(OC=C)=O)(F)F
Synonyms:- Butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, ethenyl ester
- Butanoic acid, heptafluoro-, ethenyl ester
- Butyric acid, heptafluoro-, vinyl ester
- Ethenyl 2,2,3,3,4,4,4-heptafluorobutanoate
- Ethenyl Heptafluorobutanoate
- Vinyl heptafluorobutanoate
- Vinyl heptafluorobutyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Vinyl heptafluorobutanoate
CAS:<p>Vinyl heptafluorobutanoate</p>Color and Shape:LiquidMolecular weight:240.08g/mol
