CAS 35600-34-1
:methyl carbamohydrazonothioate
Description:
Methyl carbamohydrazonothioate, identified by its CAS number 35600-34-1, is a chemical compound that belongs to the class of thioates, which are characterized by the presence of a sulfur atom bonded to a carbon atom. This compound features a methyl group, a carbamoyl group, and a hydrazone functional group, which contribute to its unique chemical properties. Methyl carbamohydrazonothioate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The compound may exhibit moderate to high toxicity to certain organisms, necessitating careful handling and usage in accordance with safety regulations. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, methyl carbamohydrazonothioate is a compound of interest in both research and industrial contexts.
Formula:C2H7N3S
InChI:InChI=1/C2H7N3S/c1-6-2(3)5-4/h4H2,1H3,(H2,3,5)
SMILES:CSC(=N)NN
Synonyms:- Carbamohydrazonothioic Acid, Methyl Ester
- Methyl carbamohydrazonothioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hydrazinecarboximidothioic acid, methyl ester, hydriodide (1:1)
CAS:Formula:C2H8IN3SPurity:95%Color and Shape:SolidMolecular weight:233.0745S-Methylisothiosemicarbazide hydroiodide
CAS:S-Methylisothiosemicarbazide hydroiodideFormula:C2H7N3S·HIPurity:≥95%Color and Shape: white solidMolecular weight:233.07g/molMethyl hydrazinecarbimidothioate hydroiodide
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:233.07000732421875Hydrazinecarboximidothioic Acid Methyl Ester Hydroiodide
CAS:Controlled Product<p>Applications Hydrazinecarboximidothioic Acid Methyl Ester Hydroiodide<br></p>Formula:C2H7N3S·(HI)Color and Shape:NeatMolecular weight:105.16 + (127.91)



