CAS 356048-02-7
:methyl 4-methyl-2-oxo-1,3,2-dioxathiolane-4-carboxylate
Description:
Methyl 4-methyl-2-oxo-1,3,2-dioxathiolane-4-carboxylate, identified by its CAS number 356048-02-7, is a chemical compound characterized by its unique dioxathiolane ring structure, which incorporates both sulfur and oxygen atoms. This compound typically exhibits properties associated with esters, including volatility and solubility in organic solvents. The presence of the carboxylate group suggests it may participate in various chemical reactions, such as esterification or nucleophilic substitutions. Its oxo group contributes to its reactivity, potentially allowing for further functionalization. Methyl 4-methyl-2-oxo-1,3,2-dioxathiolane-4-carboxylate may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential biological activity. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound exemplifies the diverse chemistry associated with sulfur-containing heterocycles.
Formula:C5H8O5S
InChI:InChI=1/C5H8O5S/c1-5(4(6)8-2)3-9-11(7)10-5/h3H2,1-2H3
SMILES:CC1(COS(=O)O1)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4S)-4-Methyl-2-oxo-[1,3,2]dioxathiolane-4-carboxylic Acid Methyl Ester
CAS:Controlled ProductApplications (4S)-4-Methyl-2-oxo-[1,3,2]dioxathiolane-4-carboxylic Acid Methyl Ester (cas# 356048-02-7) is a compound useful in organic synthesis.
Formula:C5H8O5SColor and Shape:NeatMolecular weight:180.18
