CAS 356075-79-1
:N-(3,4,5-trimethoxybenzyl)cycloheptanamine
Description:
N-(3,4,5-trimethoxybenzyl)cycloheptanamine is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and a benzyl group substituted with three methoxy groups. The presence of the methoxy groups enhances the compound's lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties due to its amine functionality, which can participate in hydrogen bonding and interact with various biological targets. The cycloheptane moiety contributes to the compound's three-dimensional conformation, which can affect its binding affinity and selectivity for receptors or enzymes. Additionally, the presence of multiple methoxy groups can impact the electronic properties of the molecule, possibly affecting its reactivity and stability. While specific applications or biological activities may vary, compounds with similar structural features are often investigated for their potential therapeutic effects in medicinal chemistry. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C17H27NO3
InChI:InChI=1/C17H27NO3/c1-19-15-10-13(11-16(20-2)17(15)21-3)12-18-14-8-6-4-5-7-9-14/h10-11,14,18H,4-9,12H2,1-3H3
SMILES:COc1cc(cc(c1OC)OC)CNC1CCCCCC1
Synonyms:- cycloheptanamine, N-[(3,4,5-trimethoxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.