CAS 356092-30-3

2-(1H-indol-3-yl)-N-(2-methylbenzyl)ethanaminium

Description:

2-(1H-indol-3-yl)-N-(2-methylbenzyl)ethanaminium, with the CAS number 356092-30-3, is a chemical compound characterized by its unique structure that includes an indole moiety and an ethanaminium group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The indole ring is known for its role in various biochemical processes and can influence the compound's interaction with biological targets. The presence of the 2-methylbenzyl substituent may enhance lipophilicity, affecting solubility and permeability in biological systems. Additionally, the ammonium group suggests that the compound may exist in a protonated form under physiological conditions, which can impact its pharmacokinetics and pharmacodynamics. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of new therapeutic agents targeting specific biological pathways. Further studies would be necessary to elucidate its specific biological activities and potential applications.

Formula: C₁₈H₂₁N₂

InChI: InChI=1/C18H20N2/c1-14-6-2-3-7-15(14)12-19-11-10-16-13-20-18-9-5-4-8-17(16)18/h2-9,13,19-20H,10-12H2,1H3/p+1

SMILES: Cc1ccccc1CNCCc1c[nH]c2ccccc12

Synonyms:

• 1H-Indole-3-ethanamine, N-[(2-methylphenyl)methyl]-

2-(1H-Indol-3-yl)-N-(2-methylbenzyl)ethanamine

CAS: 356092-30-3

Formula: C₁₈H₂₀N₂

Molecular weight: 264.3648

Ref: IN-DA00C007

[2-(1 H -Indol-3-yl)-ethyl]-(2-methyl-benzyl)-amine

CAS: 356092-30-3

Purity: 95.0%

Molecular weight: 264.37200927734375

Ref: 10-F029576