CAS 356092-88-1

N-(2,5-dimethoxybenzyl)-1,2,3,4-tetrahydronaphthalen-1-amine

Description:

N-(2,5-dimethoxybenzyl)-1,2,3,4-tetrahydronaphthalen-1-amine, with the CAS number 356092-88-1, is a chemical compound that belongs to the class of substituted amines. It features a tetrahydronaphthalene core, which is a bicyclic structure, and is substituted with a benzyl group that has two methoxy groups at the 2 and 5 positions. This substitution pattern can influence the compound's solubility, reactivity, and biological activity. The presence of methoxy groups typically enhances lipophilicity, potentially affecting the compound's pharmacokinetics and interaction with biological systems. The amine functional group suggests that it may participate in hydrogen bonding, which can be relevant in its interactions with other molecules. This compound may be of interest in medicinal chemistry and pharmacology, particularly in the context of developing new therapeutic agents. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.

Formula: C₁₉H₂₃NO₂

InChI: InChI=1/C19H23NO2/c1-21-16-10-11-19(22-2)15(12-16)13-20-18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-12,18,20H,5,7,9,13H2,1-2H3

SMILES: COc1ccc(c(c1)CNC1CCCc2ccccc12)OC