CAS 356094-07-0
:1-methoxy-N-(2,3,4-trimethoxybenzyl)propan-2-amine
Description:
1-Methoxy-N-(2,3,4-trimethoxybenzyl)propan-2-amine is a chemical compound characterized by its complex structure, which includes a propan-2-amine backbone substituted with a methoxy group and a benzyl moiety that features multiple methoxy groups. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of multiple methoxy groups on the benzyl ring may enhance its lipophilicity and potentially affect its biological activity. Additionally, the methoxy groups can influence the electronic properties of the molecule, possibly affecting its reactivity and interaction with biological targets. As a compound with a specific molecular structure, it may have applications in medicinal chemistry or as a research chemical, although detailed studies would be necessary to fully understand its pharmacological properties and potential uses. Safety data and handling precautions should be consulted due to the potential for biological activity and toxicity associated with amine compounds.
Formula:C14H23NO4
InChI:InChI=1/C14H23NO4/c1-10(9-16-2)15-8-11-6-7-12(17-3)14(19-5)13(11)18-4/h6-7,10,15H,8-9H2,1-5H3
SMILES:CC(COC)NCc1ccc(c(c1OC)OC)OC
Synonyms:- (2-Methoxy-1-methyl-ethyl)-(2,3,4-trimethoxy-benzyl)-amine
- benzenemethanamine, 2,3,4-trimethoxy-N-(2-methoxy-1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.