CAS 35610-98-1
:5-bromo-3-methyl-4-nitro-1,2-thiazole
Description:
5-Bromo-3-methyl-4-nitro-1,2-thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of a bromine atom at the 5-position, a methyl group at the 3-position, and a nitro group at the 4-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is soluble in organic solvents. It exhibits notable reactivity due to the electron-withdrawing nature of the nitro group and the halogen substituent, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The thiazole ring system is known for its biological activity, and derivatives of this compound may exhibit antimicrobial or antifungal properties. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 5-bromo-3-methyl-4-nitro-1,2-thiazole is a valuable compound in organic chemistry with potential applications in medicinal chemistry and materials science.
Formula:C4H3BrN2O2S
InChI:InChI=1/C4H3BrN2O2S/c1-2-3(7(8)9)4(5)10-6-2/h1H3
SMILES:Cc1c(c(Br)sn1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Bromo-3-methyl-4-nitro-isothiazole
CAS:5-Bromo-3-methyl-4-nitro-isothiazole
Color and Shape:Beige SolidMolecular weight:223.05g/mol
