CAS 35615-97-5

methyl 4-bromonaphthalene-1-carboxylate

Description:

Methyl 4-bromonaphthalene-1-carboxylate is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a bromine atom and a carboxylate ester functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is often utilized in organic synthesis, particularly in the preparation of more complex molecules. Its solubility is generally moderate in organic solvents, while it is less soluble in water due to the hydrophobic nature of the naphthalene moiety. Methyl 4-bromonaphthalene-1-carboxylate may exhibit biological activity, and its derivatives can be explored for potential applications in pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with bromine-containing substances.

Formula: C₁₂H₉BrO₂

InChI: InChI=1/C12H9BrO2/c1-15-12(14)10-6-7-11(13)9-5-3-2-4-8(9)10/h2-7H,1H3

SMILES: COC(=O)c1ccc(c2ccccc12)Br

Methyl 4-bromo-1-naphthoate

CAS: 35615-97-5

Formula: C₁₂H₉BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 265.1027

Ref: IN-DA003RUO

Methyl 4-bromo-1-naphthoate

CAS: 35615-97-5

Methyl 4-bromo-1-naphthoate

Formula: C₁₂H₉BrO₂

Purity: 97%

Color and Shape: brown solid

Molecular weight: 265.10266g/mol

Ref: 54-OR11449

Methyl 4-bromo-1-naphthoate

CAS: 35615-97-5

Formula: C₁₂H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.106

Ref: 10-F216555