CAS 3562-15-0

2-methyl-2-[(2-methylpropyl)amino]propyl benzoate hydrochloride (1:1)

Description:

2-Methyl-2-[(2-methylpropyl)amino]propyl benzoate hydrochloride is a chemical compound characterized by its structure, which includes a benzoate moiety and an amino group. This substance is typically a white to off-white crystalline powder, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. It exhibits basic properties due to the amino group, allowing it to interact with acids to form the hydrochloride salt. The compound may be used in various applications, including pharmaceuticals, where it could serve as an intermediate or active ingredient. Its molecular structure suggests potential biological activity, which may be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-methyl-2-[(2-methylpropyl)amino]propyl benzoate hydrochloride is notable for its unique structural features and potential applications in chemical and pharmaceutical contexts.

Formula: C₁₅H₂₄ClNO₂

InChI: InChI=1/C15H23NO2.ClH/c1-12(2)10-16-15(3,4)11-18-14(17)13-8-6-5-7-9-13;/h5-9,12,16H,10-11H2,1-4H3;1H

SMILES: CC(C)CNC(C)(C)COC(=O)c1ccccc1.Cl

Isobucaine Hydrochloride

Controlled Product

CAS: 3562-15-0

Formula: C₁₅H₂₃NO₂·ClH

Color and Shape: Neat

Molecular weight: 285.81

Ref: TR-I780035

Isobucaine hydrochloride

CAS: 3562-15-0

Isobucaine hydrochloride is a local anesthetic.

Formula: C₁₅H₂₄ClNO₂

Color and Shape: Solid

Molecular weight: 285.81

Ref: TM-T32204