
CAS 3562-38-7
:Phenazinium, 3,7-bis(diethylamino)-5-phenyl-, chloride (1:1)
Description:
Phenazinium, 3,7-bis(diethylamino)-5-phenyl-, chloride (1:1), commonly referred to as a phenazinium dye, is a synthetic organic compound characterized by its vibrant color and application in various fields, including biological staining and as a redox indicator. This compound features a phenazinium core, which is a bicyclic structure containing nitrogen atoms, contributing to its stability and reactivity. The presence of two diethylamino groups enhances its solubility in organic solvents and aqueous solutions, making it useful in biological applications. The phenyl group attached to the phenazinium structure can influence its electronic properties, affecting its absorption spectrum and color characteristics. As a chloride salt, it exists in a stable ionic form, which is crucial for its solubility and interaction with other substances. The compound is typically handled with care due to potential toxicity and should be stored in a cool, dry place away from light to maintain its integrity. Overall, this compound is significant in research and industrial applications due to its unique chemical properties and versatility.
Formula:C26H31N4·Cl
InChI:InChI=1S/C26H31N4.ClH/c1-5-28(6-2)21-14-16-23-25(18-21)30(20-12-10-9-11-13-20)26-19-22(29(7-3)8-4)15-17-24(26)27-23;/h9-19H,5-8H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=OVYHWGDANKJLIW-UHFFFAOYSA-M
SMILES:N(CC)(CC)C1=CC=2[N+](=C3C(=NC2C=C1)C=CC(N(CC)CC)=C3)C4=CC=CC=C4.[Cl-]
Synonyms:- Heliotrope B
- C.I. 50225
- Phenazinium, 3,7-bis(diethylamino)-5-phenyl-, chloride
- Phenazinium, 3,7-bis(diethylamino)-5-phenyl-, chloride (1:1)
- Amethyst violet
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Heliotrope B
CAS:Heliotrope B is a biochemical.Formula:C26H31ClN4Color and Shape:SolidMolecular weight:435Heliotrope B
CAS:Heliotrope B is a film-forming polymer that has been shown to have anticancer properties. It has been used in the treatment of brain tumors, and other cancers such as melanoma and lymphoma, by local administration. Heliotrope B inhibits the growth of cancer cells by binding to their surface membrane receptors. This binding leads to a loss of cell adhesion and prevents tumor cells from attaching to surrounding tissues. Heliotrope B also has antiviral effects against hepatitis viruses, including types A, B, and C. It binds to viral particles and inhibits virus entry into the cell. In addition, heliotrope B can be used in the treatment of HIV infection through its ability to block messenger RNA synthesis by inhibiting reverse transcriptase activity. The polymer is also effective against bacterial strains such as Staphylococcus aureus and Escherichia coli because it disrupts their outer membranes. Heliotrope B has an acidic pH level that makes itFormula:C26H31ClN4Purity:Min. 95%Molecular weight:435 g/mol

