CAS 35622-80-1

3,5-dichloro-2-fluoro-6-methoxypyridin-4-amine

Description:

3,5-Dichloro-2-fluoro-6-methoxypyridin-4-amine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two chlorine atoms at the 3 and 5 positions, a fluorine atom at the 2 position, and a methoxy group at the 6 position, along with an amino group at the 4 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and methoxy functional groups. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or medicinal compounds, owing to the presence of halogen substituents which can enhance biological activity. Additionally, the compound's characteristics may include specific melting and boiling points, as well as distinct spectral properties that can be analyzed using techniques such as NMR or mass spectrometry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity or environmental impact.

Formula: C₆H₅Cl₂FN₂O

InChI: InChI=1/C6H5Cl2FN2O/c1-12-6-3(8)4(10)2(7)5(9)11-6/h1H3,(H2,10,11)

SMILES: COc1c(c(c(c(F)n1)Cl)N)Cl

3,5-Dichloro-2-fluoro-6-methoxypyridin-4-amine

CAS: 35622-80-1

Formula: C₆H₅Cl₂FN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.0211

Ref: IN-DA0079ZP

Fluroxypyr-2-methoxy

CAS: 35622-80-1

Fluroxypyr-2-methoxy

Formula: C₆H₅Cl₂FN₂O

Purity: 95%

Color and Shape: white. wooly crystalline needles

Molecular weight: 211.02g/mol

Ref: 54-PC56755

Fluroxypyr-2-methoxy

Controlled Product

CAS: 35622-80-1

Formula: C₆H₅Cl₂FN₂O

Color and Shape: Neat

Molecular weight: 211.02

Ref: 04-C13849910

3,5-Dichloro-2-fluoro-6-methoxypyridin-4-amine

CAS: 35622-80-1

Purity: 95%

Molecular weight: 211.0200043

Ref: 10-F619571