CAS 35623-11-1

3-(methylsulfamoyl)benzoate

Description:

3-(Methylsulfamoyl)benzoate, identified by its CAS number 35623-11-1, is an organic compound characterized by the presence of a benzoate group substituted with a methylsulfamoyl moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The methylsulfamoyl group contributes to the compound's solubility in polar solvents, while the benzoate portion provides aromatic stability and potential for further functionalization. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of both the sulfonamide and carboxylate functionalities suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3-(methylsulfamoyl)benzoate represents a versatile structure with potential utility in various chemical and biological contexts.

Formula: C₈H₈NO₄S

InChI: InChI=1/C8H9NO4S/c1-9-14(12,13)7-4-2-3-6(5-7)8(10)11/h2-5,9H,1H3,(H,10,11)/p-1

SMILES: CNS(=O)(=O)c1cccc(c1)C(=O)O

Synonyms:

• Benzoic acid, 3-[(methylamino)sulfonyl]-

3-(N-Methylsulfamoyl)benzoic acid

CAS: 35623-11-1

Formula: C₈H₉NO₄S

Purity: 96%

Color and Shape: Solid

Molecular weight: 215.2264

Ref: IN-DA003IRO

3-(Methylsulphamoyl)benzoic acid

CAS: 35623-11-1

3-(Methylsulphamoyl)benzoic acid

Formula: C₈H₉NO₄S

Purity: 97%

Color and Shape: beige solid

Molecular weight: 215.23g/mol

Ref: 54-OR14836

3-(N-Methylsulfamoyl)benzoic acid

CAS: 35623-11-1

Formula: C₈H₉NO₄S

Purity: 96%

Molecular weight: 215.22

Ref: 10-F218272

3-(Methylsulfamoyl)benzoic acid

CAS: 35623-11-1

3-(Methylsulfamoyl)benzoic acid (MSBA) is a nitro compound that inhibits cancer cell growth by binding to the DNA of cancer cells. It is also an inhibitor that binds to the enzyme cyclin-dependent kinase 2, which is involved in cell division. 3-(Methylsulfamoyl)benzoic acid has been shown to inhibit the growth of cancer cells in culture and inhibits tumor formation in mice, but it does not have any effect on normal cells. The mechanism of action may be due to its ability to inhibit the production of amines, which are necessary for the synthesis of DNA and RNA.

Formula: C₈H₉NO₄S

Purity: Min. 95%

Molecular weight: 215.23 g/mol

Ref: 3D-KBA62311