CAS 35629-71-1

2-Amino-4-(trifluoromethyl)oxazole

Description:

2-Amino-4-(trifluoromethyl)oxazole is a heterocyclic organic compound characterized by the presence of an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. The compound features an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to the oxazole ring, which significantly influences its chemical properties and reactivity. The trifluoromethyl group is known for imparting lipophilicity and enhancing the compound's biological activity, making it of interest in medicinal chemistry. This substance is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the presence of the amino group can facilitate various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many fluorinated compounds, 2-Amino-4-(trifluoromethyl)oxazole may exhibit distinct physical and chemical properties, such as increased stability and altered reactivity compared to its non-fluorinated counterparts.

Formula: C₇H₅F₇O₂

InChI: InChI=1/C7H5F7O2/c1-3(15)2-4(16)5(8,9)6(10,11)7(12,13)14/h2H2,1H3

SMILES: CC(=O)CC(=O)C(C(C(F)(F)F)(F)F)(F)F

Synonyms:

• 2-Oxazolamine, 4-(trifluoromethyl)-
• 4-(Trifluoromethyl)-1,3-oxazol-2-amine
• 4-(Trifluoromethyl)Oxazol-2-Amine
• 5,5,6,6,7,7,7-Heptafluoroheptane-2,4-Dione

4-(Trifluoromethyl)oxazol-2-amine

CAS: 35629-71-1

Formula: C₄H₃F₃N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.0746

Ref: IN-DA0079ZE

2-Amino-4-(trifluoromethyl)oxazole

CAS: 35629-71-1

2-Amino-4-(trifluoromethyl)oxazole

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.07g/mol

Ref: 54-PC5206

4-Trifluoromethyl-oxazol-2-ylamine

CAS: 35629-71-1

Formula: C₄H₃F₃N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.076

Ref: 10-F032831