CAS 3563-01-7
:Aprophen
Description:
Aprophen, with the CAS number 3563-01-7, is a chemical compound that belongs to the class of phenothiazines, which are primarily known for their use in medicinal applications, particularly as antipsychotic agents. This substance exhibits properties that allow it to interact with various neurotransmitter systems in the brain, making it relevant in the treatment of psychiatric disorders. Aprophen is characterized by its ability to act as an antagonist at certain dopamine receptors, which can help alleviate symptoms of psychosis. Additionally, it may possess antihistaminic and anticholinergic properties, contributing to its therapeutic effects. The compound is typically administered in a controlled dosage form, and its pharmacokinetics can vary based on individual patient factors. Safety and efficacy profiles are essential considerations in its use, as with any pharmaceutical agent. As with many drugs, potential side effects and contraindications should be carefully evaluated before administration. Overall, Aprophen represents a significant compound within the realm of psychopharmacology, with ongoing research into its full range of effects and applications.
Formula:C21H27NO2
InChI:InChI=1S/C21H27NO2/c1-4-22(5-2)16-17-24-20(23)21(3,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15H,4-5,16-17H2,1-3H3
InChI key:InChIKey=DIDYGLSKVUKRRP-UHFFFAOYSA-N
SMILES:C(C(OCCN(CC)CC)=O)(C)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Benzeneacetic acid, α-methyl-α-phenyl-, 2-(diethylamino)ethyl ester
- Propionic acid, 2,2-diphenyl-, 2-(diethylamino)ethyl ester
- Aprofene
- Aprophen
- 2,2-Diphenyl-propionic acid 2-diethylamino-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
