CAS 356539-02-1

[2-(azepan-1-ylmethyl)phenyl]methanol

Description:

[2-(azepan-1-ylmethyl)phenyl]methanol, identified by its CAS number 356539-02-1, is a chemical compound that features a phenyl group substituted with a methanol moiety and an azepane ring. This compound typically exhibits characteristics associated with both aromatic and aliphatic structures, which can influence its solubility, reactivity, and interaction with biological systems. The presence of the azepane ring, a seven-membered saturated nitrogen-containing heterocycle, contributes to its potential as a pharmacophore in medicinal chemistry, possibly affecting its binding affinity and selectivity for biological targets. The hydroxyl group from the methanol portion can participate in hydrogen bonding, enhancing its solubility in polar solvents and influencing its biological activity. Overall, the unique structural features of [2-(azepan-1-ylmethyl)phenyl]methanol suggest potential applications in drug development, particularly in areas requiring compounds with specific pharmacological properties. Further studies would be necessary to elucidate its full range of characteristics and potential uses.

Formula: C₁₄H₂₁NO

InChI: InChI=1/C14H21NO/c16-12-14-8-4-3-7-13(14)11-15-9-5-1-2-6-10-15/h3-4,7-8,16H,1-2,5-6,9-12H2

SMILES: C1CCCN(CC1)Cc1ccccc1CO

[2-(Azepan-1-ylmethyl)phenyl]methanol

CAS: 356539-02-1

Formula: C₁₄H₂₁NO

Molecular weight: 219.3226

Ref: IN-DA00C0GN

[2-(azepan-1-ylmethyl)phenyl]methanol

CAS: 356539-02-1

Formula: C₁₄H₂₁NO

Purity: 95.0%

Molecular weight: 219.328

Ref: 10-F308058