CAS 356539-83-8
:N-benzyl-1-cyclobutylmethanamine
Description:
N-benzyl-1-cyclobutylmethanamine is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a benzyl moiety attached to a methanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The cyclobutyl ring contributes to its rigidity and may influence its conformational behavior, while the benzyl group can enhance lipophilicity, potentially affecting its solubility in organic solvents. N-benzyl-1-cyclobutylmethanamine may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific reactivity and interactions can vary based on the presence of substituents and the overall molecular environment. As with many amines, it may participate in various chemical reactions, including alkylation and acylation, and can serve as a building block for synthesizing more complex molecules. Safety and handling considerations should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H17N
InChI:InChI=1/C12H17N/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-12/h1-3,5-6,12-13H,4,7-10H2
SMILES:c1ccc(cc1)CNCC1CCC1
Synonyms:- benzenemethanamine, N-(cyclobutylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(Cyclobutylmethyl)(phenyl)methanamine
CAS:<p>The compound N-(Cyclobutylmethyl)(phenyl)methanamine is a non-polar molecule that has been screened for its ability to interact with other compounds. It has been shown to be able to form hydrogen bonds with carboxylic acids, water molecules, and other polar compounds. This compound was used in experimental studies on the interaction of organic solvents with aqueous solutions. It is hypothetically possible that this molecule can be used as a solvent extraction agent.</p>Formula:C12H17NPurity:Min. 95%Molecular weight:175.28 g/mol
