CAS 356560-80-0

6-Bromo-[1,2,4]triazolo[1,5-a]pyridine

Description:

6-Bromo-[1,2,4]triazolo[1,5-a]pyridine is a heterocyclic compound characterized by the presence of a triazole ring fused to a pyridine ring, with a bromine substituent at the 6-position of the triazole. This compound typically exhibits a molecular formula that reflects its complex structure, which includes nitrogen atoms integral to the triazole moiety. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can influence its reactivity and solubility, as well as its interaction with biological targets. Additionally, the compound may exhibit properties such as moderate to high stability under standard conditions, and it may be soluble in organic solvents. Its unique structure allows for various synthetic modifications, which can lead to derivatives with enhanced pharmacological properties. Overall, 6-Bromo-[1,2,4]triazolo[1,5-a]pyridine serves as a valuable scaffold in the exploration of new therapeutic agents.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-1-2-6-8-4-9-10(6)3-5/h1-4H

SMILES: c1cc2ncnn2cc1Br

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyridine, 6-bromo-
• 6-Bromo[1,2,4]triazolo[1,5-a]pyridine

6-Bromo-[1,2,4]triazolo[1,5-a]pyridine

CAS: 356560-80-0

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA00BYH9

6-Bromo[1,2,4]triazolo[1,5-a]pyridine

CAS: 356560-80-0

6-Bromo[1,2,4]triazolo[1,5-a]pyridine

Formula: C₆H₄BrN₃

Purity: 96%

Color and Shape: pale yellow solid

Molecular weight: 198.02g/mol

Ref: 54-OR3552

6-Bromo-1,2,4-triazolo-1,5-a-pyridine

CAS: 356560-80-0

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F048870