CAS 356561-08-5

2-Amino-5-iodo-4-methylpyridine

Description:

2-Amino-5-iodo-4-methylpyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an amino group, an iodine atom, and a methyl group. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The amino group (-NH2) enhances its nucleophilicity, making it a useful intermediate in various chemical syntheses. The iodine substituent can participate in electrophilic aromatic substitution reactions and may also serve as a leaving group in nucleophilic displacement reactions. The methyl group contributes to the compound's hydrophobic character and can influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, 2-Amino-5-iodo-4-methylpyridine is a versatile compound with applications in organic synthesis and potential pharmaceutical relevance.

Formula: C₆H₇IN₂

InChI: InChI=1/C6H7IN2/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3,(H2,8,9)

SMILES: Cc1cc(=N)[nH]cc1I

Synonyms:

• 2-Pyridinamine, 5-Iodo-4-Methyl-
• 5-Iodo-4-methylpyridin-2-amine

2-Amino-5-iodo-4-methylpyridine

CAS: 356561-08-5

Formula: C₆H₇IN₂

Purity: >98.0%(GC)(T)

Color and Shape: Light yellow to Brown to Dark green powder to crystal

Molecular weight: 234.04

Ref: 3B-A2880

2-Amino-5-iodo-4-methylpyridine

CAS: 356561-08-5

Formula: C₆H₇IN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.0377

Ref: IN-DA003GH4

2-Amino-5-iodo-4-methylpyridine

CAS: 356561-08-5

2-Amino-5-iodo-4-methylpyridine

Purity: 98%

Molecular weight: 234.04g/mol

Ref: 54-OR310075

2-Amino-5-iodo-4-methylpyridine

CAS: 356561-08-5

Formula: C₆H₇IN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.04

Ref: 10-F217491