CAS 356568-72-4

Ethyl 2-[(2-chloroacetyl)amino]-4-(2-furanyl)-3-thiophenecarboxylate

Description:

Ethyl 2-[(2-chloroacetyl)amino]-4-(2-furanyl)-3-thiophenecarboxylate, identified by its CAS number 356568-72-4, is a chemical compound that features a complex structure incorporating both furan and thiophene rings, which are known for their aromatic properties. This compound contains an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the chloroacetyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The thiophene and furan moieties may impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Additionally, the compound's structure indicates potential biological activity, which could be explored in pharmacological studies. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. Overall, this compound exemplifies the diverse chemistry associated with heterocyclic compounds and their potential applications in various fields.

Formula: C₁₃H₁₂ClNO₄S

InChI: InChI=1S/C13H12ClNO4S/c1-2-18-13(17)11-8(9-4-3-5-19-9)7-20-12(11)15-10(16)6-14/h3-5,7H,2,6H2,1H3,(H,15,16)

InChI key: InChIKey=LJJKQPZCYYCVDH-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=CSC1NC(CCl)=O)C2=CC=CO2

Synonyms:

• Ethyl 2-[(2-chloroacetyl)amino]-4-(2-furanyl)-3-thiophenecarboxylate
• Ethyl 2-[(chloroacetyl)amino]-4-(2-furyl)thiophene-3-carboxylate
• 3-Thiophenecarboxylic acid, 2-[(2-chloroacetyl)amino]-4-(2-furanyl)-, ethyl ester
• 3-thiophenecarboxylic acid, 2-[(2-chloroacetyl)amino]-4-(2-furanyl)-, ethyl ester
• 3-Thiophenecarboxylic acid, 2-[(chloroacetyl)amino]-4-(2-furanyl)-, ethyl ester

Ethyl 2-(2-chloroacetamido)-4-(furan-2-yl)thiophene-3-carboxylate

CAS: 356568-72-4

Versatile small molecule scaffold

Formula: C₁₃H₁₂ClNO₄S

Purity: Min. 95%

Molecular weight: 313.76 g/mol

Ref: 3D-GPA56872