CAS 35657-41-1

tert-butyl [(4-nitrobenzoyl)oxy]carbamate

Description:

Tert-butyl [(4-nitrobenzoyl)oxy]carbamate, with the CAS number 35657-41-1, is an organic compound characterized by its carbamate functional group, which is linked to a tert-butyl group and a 4-nitrobenzoyloxy moiety. This compound typically appears as a solid or crystalline substance and is known for its stability under standard conditions. It is often utilized in organic synthesis and medicinal chemistry due to its ability to serve as a protecting group for amines and its potential role in drug development. The presence of the nitro group enhances its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the tert-butyl group contributes to the compound's steric hindrance, influencing its solubility and reactivity profile. Safety data sheets should be consulted for handling and storage guidelines, as compounds containing nitro groups can pose specific hazards. Overall, tert-butyl [(4-nitrobenzoyl)oxy]carbamate is a valuable compound in synthetic organic chemistry with diverse applications.

Formula: C₁₂H₁₄N₂O₆

InChI: InChI=1/C12H14N2O6/c1-12(2,3)19-11(16)13-20-10(15)8-4-6-9(7-5-8)14(17)18/h4-7H,1-3H3,(H,13,16)

SMILES: CC(C)(C)OC(=NOC(=O)c1ccc(cc1)N(=O)=O)O

Synonyms:

• [(2-methylpropan-2-yl)oxycarbonylamino] 4-nitrobenzoate
• tert-Butyl (4-nitrobenzoyl)oxycarbaMate
• Benzoic acid, 4-nitro-, [(1,1-dimethylethoxy)carbonyl]azanyl ester

tert-Butyl (4-nitrobenzoyl)oxycarbamate

CAS: 35657-41-1

Formula: C₁₂H₁₄N₂O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 282.2494

Ref: IN-DA00CN4U

tert-Butyl (4-nitrobenzoyl)oxycarbamate

CAS: 35657-41-1

Formula: C₁₂H₁₄N₂O₆

Purity: 95.0%

Molecular weight: 282.252

Ref: 10-F421833