CAS 3567-00-8
:Rubrofusarin
Description:
Rubrofusarin, with the CAS number 3567-00-8, is a natural compound classified as a phenolic compound. It is primarily derived from certain fungi and has been studied for its potential biological activities. Rubrofusarin exhibits a characteristic red to reddish-brown color, which is indicative of its structure and the presence of conjugated double bonds. This compound is known for its antioxidant properties, which may contribute to its potential health benefits. Additionally, rubrofusarin has been investigated for its antimicrobial and antifungal activities, making it of interest in various fields, including pharmaceuticals and food preservation. Its solubility in organic solvents and limited solubility in water are typical for many phenolic compounds, influencing its applications in different environments. As research continues, the full scope of rubrofusarin's properties and potential uses in medicine and industry is still being explored.
Formula:C15H12O5
InChI:InChI=1S/C15H12O5/c1-7-3-10(16)14-12(20-7)5-8-4-9(19-2)6-11(17)13(8)15(14)18/h3-6,17-18H,1-2H3
InChI key:InChIKey=FPNKCZKRICBAKG-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C3C1C(=O)C=C(C)O3)C=C(OC)C=C2O
Synonyms:- 4H-naphtho[2,3-b]pyran-4-one, 5,6-dihydroxy-8-methoxy-2-methyl-
- 5,6-Dihydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- 5,6-Dihydroxy-8-methoxy-2-methyl-benzo[g]chromen-4-one
- NSC 258316
- Rubrofusarin
- 5,6-Dihydroxy-8-methoxy-2-methyl-4H-benzo[g]chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Rubrofusarin
CAS:Rubrofusarin is an orange polyketide pigment.Formula:C15H12O5Color and Shape:SolidMolecular weight:272.25Rubrofusarin
CAS:Formula:C15H12O5Purity:(HPLC) ≥ 98.0%Color and Shape:Orange crystalline solidMolecular weight:272.3Rubrofusarin
CAS:Rubrofusarin is a polyphenolic compound that is found in the seeds of Rhus verniciflua. It has anti-inflammatory activity and binds to target enzymes such as cyclic nucleotide phosphodiesterase, which is responsible for the breakdown of cyclic nucleotides. Rubrofusarin also inhibits growth factor-β1, which is an important mediator of inflammatory reactions. Rubrofusarin has been shown to have hypoglycemic effects and can be used as a drug to treat diabetes mellitus type 2. The target for rubrofusarin appears to be P-glycoprotein (P-gp), which is a molecule that transports drugs from outside cells into cells. Rubrofusarin may inhibit P-gp by binding to the enzyme and preventing it from functioning properly or by inhibiting its synthesis.Formula:C15H12O5Purity:Min. 95%Molecular weight:272.25 g/mol


