CAS 3567-76-8

6-amino-2-(2-chloroethyl)-2,3-dihydro-4H-1,3-benzoxazin-4-one

Description:

6-Amino-2-(2-chloroethyl)-2,3-dihydro-4H-1,3-benzoxazin-4-one, with the CAS number 3567-76-8, is a chemical compound characterized by its unique structure, which includes a benzoxazine ring. This compound features an amino group and a chloroethyl substituent, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The benzoxazine moiety is known for its applications in polymer chemistry and as a precursor in the synthesis of various organic compounds. Additionally, compounds of this class may exhibit antimicrobial or anticancer properties, making them of interest in medicinal chemistry. Safety data should be consulted for handling, as the chloroethyl group may impart toxicity or reactivity. Overall, this compound represents a versatile structure with potential applications in both industrial and pharmaceutical contexts.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1/C10H11ClN2O2/c11-4-3-9-13-10(14)7-5-6(12)1-2-8(7)15-9/h1-2,5,9H,3-4,12H2,(H,13,14)

SMILES: c1cc2c(cc1N)C(=NC(CCCl)O2)O

Synonyms:

• 2-(b-Chloroethyl)-2,3-dihydro-4-oxo-6-amino-1,3-benzoxazine
• 3567-76-8
• 6-Amino-2-(2-chloroethyl)-2,3-dihydro-4H-1,3-benzoxazin-4-one

Aminochlorthenoxazin

CAS: 3567-76-8

Aminochlorthenoxazin is an antipyretic and analgesic agent.

Formula: C₁₀H₁₁ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.66

Ref: TM-T10304