CAS 35674-27-2
:4-Iodo-3-nitrobenzoic acid
Description:
4-Iodo-3-nitrobenzoic acid is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a benzoic acid structure. Its molecular formula is C7H4I-NO4, indicating that it contains seven carbon atoms, four hydrogen atoms, one iodine atom, and four oxygen atoms. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. The presence of the nitro group contributes to its acidic properties, making it a weak acid. 4-Iodo-3-nitrobenzoic acid is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. It may also exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability.
Formula:C7H4INO4
InChI:InChI=1/C7H4INO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11)
SMILES:c1cc(c(cc1C(=O)O)N(=O)=O)I
Synonyms:- 3-Nitro-4-iodobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Iodo-3-nitrobenzoic Acid
CAS:Formula:C7H4INO4Purity:>97.0%(GC)(T)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:293.024-Iodo-3-nitrobenzoic acid
CAS:Formula:C7H4INO4Purity:97%Color and Shape:SolidMolecular weight:293.01544-Iodo-3-nitrobenzoic acid
CAS:4-Iodo-3-nitrobenzoic acidFormula:C7H4INO4Purity:97%Color and Shape: faint to light yellow powderMolecular weight:293.02g/mol4-Iodo-3-nitrobenzoic acid
CAS:4-Iodo-3-nitrobenzoic acid (4-INBA) is a nitro derivative of the aromatic acid. It is used as a chemotherapeutic agent and an intermediate in the synthesis of other drugs. 4-INBA has been shown to be cytotoxic to hamsters and inhibit cellular growth by binding to DNA polymerase and inhibiting DNA synthesis. 4-INBA also binds to RNA polymerase, inhibiting RNA synthesis and protein production, which causes cell death.Formula:C7H4INO4Purity:90%Color and Shape:PowderMolecular weight:293.02 g/mol4-Iodo-3-nitrobenzoic acid
CAS:Formula:C7H4INO4Purity:97%Color and Shape:Solid, Yellow crystalline powderMolecular weight:293.016




