CAS 35674-28-3
:5-iodo-2-nitrobenzoic acid
Description:
5-Iodo-2-nitrobenzoic acid is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a benzoic acid structure. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The iodine substituent at the 5-position and the nitro group at the 2-position on the benzene ring influence its reactivity and solubility. Typically, compounds like 5-iodo-2-nitrobenzoic acid exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the halogen and nitro groups can enhance electrophilic substitution reactions. This compound is often utilized in organic synthesis and medicinal chemistry, serving as an intermediate in the preparation of various pharmaceuticals and agrochemicals. Its unique structural features also make it a subject of study in the field of materials science and chemical biology, where it may be used to explore interactions with biological systems or as a building block for more complex molecules.
Formula:C7H4INO4
InChI:InChI=1/C7H4INO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,(H,10,11)
SMILES:c1cc(c(cc1I)C(=O)O)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Iodo-2-nitrobenzoic acid
CAS:Formula:C7H4INO4Purity:97%Color and Shape:SolidMolecular weight:293.01545-Iodo-2-nitrobenzoic acid
CAS:<p>5-Iodo-2-nitrobenzoic acid is a fine chemical that is used as a building block in the synthesis of complex compounds and research chemicals. This compound has been shown to be an effective reagent for the synthesis of many different types of compounds. It can also be used as a reactant or intermediate in organic syntheses, such as those involving cross-coupling reactions. 5-Iodo-2-nitrobenzoic acid is a versatile building block that can be used in both simple and complex chemical reactions.</p>Formula:C7H4INO4Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:293.02 g/mol
