CAS 35676-70-1
:3-chloroquinoxalin-2(1H)-one
Description:
3-Chloroquinoxalin-2(1H)-one is a heterocyclic compound characterized by its quinoxaline core, which consists of a fused bicyclic structure containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a carbonyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a crystalline solid and is soluble in organic solvents, reflecting its moderate polarity. It exhibits potential biological activity, making it of interest in medicinal chemistry, particularly for its role in the development of pharmaceuticals. The compound may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, due to the reactivity of the chlorine atom and the electron-rich nature of the quinoxaline ring. Additionally, its structure allows for the possibility of forming derivatives that could enhance its biological activity or alter its physicochemical properties. Overall, 3-chloroquinoxalin-2(1H)-one is a valuable compound in both synthetic and medicinal chemistry contexts.
Formula:C8H5ClN2O
InChI:InChI=1/C8H5ClN2O/c9-7-8(12)11-6-4-2-1-3-5(6)10-7/h1-4H,(H,11,12)
SMILES:c1ccc2c(c1)nc(c(=O)[nH]2)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-chloro-1,2-dihydroquinoxalin-2-one
CAS:Formula:C8H5ClN2OPurity:96%Color and Shape:SolidMolecular weight:180.59112-Chloro-3-hydroxyquinoxaline
CAS:2-Chloro-3-hydroxyquinoxalinePurity:95%Molecular weight:180.59g/mol2-Chloro-3-hydroxyquinoxaline
CAS:2-Chloro-3-hydroxyquinoxaline is a chemical compound that belongs to the group of nitrones. It can be synthesized from 2,4,6-trichloro-1,3,5-triazine and amines. The yields are quite high with a range of 60%-90%. 2-Chloro-3-hydroxyquinoxaline can be used as a starting material for the synthesis of substituted quinoxalinones by coupling with nitro compounds or halides. 2-Chloro-3-hydroxyquinoxaline has been found to have pharmacological effects on biological systems in x ray analysis. It is also used in the synthesis of annulated quinoxalinones.Formula:C8H5N2OClPurity:Min. 95%Molecular weight:180.59 g/mol



