CAS 356782-33-7
:2-oxo-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylic acid
Description:
2-Oxo-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylic acid is a chemical compound characterized by its chromene structure, which features a fused benzene and pyran ring. This compound contains a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the phenyl group enhances its aromatic character and may influence its solubility and interaction with other molecules. The oxo group (carbonyl) at the 2-position and the dihydro configuration indicate that the compound may exhibit specific stereochemical properties, affecting its biological activity and potential applications. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to various pharmacological effects. Additionally, its unique structure may allow for further derivatization, making it a valuable intermediate in organic synthesis. Overall, 2-oxo-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylic acid presents a combination of functional groups that can be explored for diverse chemical and biological applications.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c17-15-9-12(10-4-2-1-3-5-10)13-8-11(16(18)19)6-7-14(13)20-15/h1-8,12H,9H2,(H,18,19)
SMILES:c1ccc(cc1)C1CC(=O)Oc2ccc(cc12)C(=O)O
Synonyms:- 6-CARBOXYL-4-PHENYL-3,4-DIHYDROCOUMARIN
- 3,4-Dihydro-2-oxo-4-phenyl-2H-1-benzopyran-6-carboxylic Acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Carboxyl-4-phenyl-3,4-dihydrocoumarin
CAS:Controlled ProductFormula:C16H12O4Color and Shape:NeatMolecular weight:268.26
