CAS 356783-31-8
:6-Fluoro-3,4-dihydro-3-oxo-2-pyrazinecarbonitrile
Description:
6-Fluoro-3,4-dihydro-3-oxo-2-pyrazinecarbonitrile is a chemical compound characterized by its unique pyrazine ring structure, which incorporates a fluorine atom and a cyano group. This compound typically exhibits a molecular formula that reflects its heterocyclic nature, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The carbonitrile functional group is known for its reactivity, often participating in nucleophilic addition reactions. Additionally, the diketone functionality within the structure may contribute to its ability to form chelates with metal ions, which can be relevant in various chemical and biological contexts. The compound's properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Overall, 6-Fluoro-3,4-dihydro-3-oxo-2-pyrazinecarbonitrile is of interest in medicinal chemistry and drug development due to its potential pharmacological applications.
Formula:C5H2FN3O
InChI:InChI=1S/C5H2FN3O/c6-4-2-8-5(10)3(1-7)9-4/h2H,(H,8,10)
InChI key:InChIKey=LJZHACRGZWYTAX-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=O)NC=C(F)N1
Synonyms:- 5-fluoro-2-oxo-1H-pyrazine-3-carbonitrile
- 6-Fluoro-3,4-dihydro-3-oxo-2-pyrazinecarbonitrile
- 6-Fluoro-3-hydroxypyrazine-2-carbonitrile
- 6-Fluoro-3-oxo-3,4-dihydro-2-pyrazinecarbonitrile
- Pyrazinecarbonitrile, 6-fluoro-3,4-dihydro-3-oxo-
- 2-Pyrazinecarbonitrile, 6-fluoro-3,4-dihydro-3-oxo-
- 6-fluoro-3-oxo-3,4-dihydropyrazine-2-carbonitrile
- FAVIPIRAVIR intermediate N-1
- Favipiravir Impurity 13
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Fluoro-3-Oxo-3,4-Dihydropyrazine-2-Carbonitrile
CAS:Formula:C5H2FN3OPurity:97%Color and Shape:SolidMolecular weight:139.0873Favipiravir Impurity 13
CAS:Formula:C5H2FN3OColor and Shape:White To Off-White SolidMolecular weight:139.096-Fluoro-3-hydroxypyrazine-2-carbonitrile
CAS:Controlled ProductFormula:C5H2FN3OColor and Shape:NeatMolecular weight:139.0876-Fluoro-3-oxo-3,4-dihydro-2-pyrazinecarbonitrile
CAS:Dibenzylamine is a tertiary amine with the chemical formula C6H12N2. Dibenzylamine is a colorless liquid that boils at 110°C and freezes at -50°C. It has a density of 0.859 g/mL and a refractive index of 1.539. When heated, it decomposes to form dipropylamine, dibutylamine, and dicyclohexylamine. It also reacts with nitric acid to form an explosive compound called nitrobenzene or dinitrobenzene. Dipropylamine is a colorless volatile liquid that has the chemical formula C6H12N2 and boils at 130°C. When heated, it decomposes to form dibutylamine and dicyclohexylamine. Dibutylamine is a colorless volatile liquid that has the chemical formula C6Formula:C5H2FN3OPurity:Min. 95%Molecular weight:139.09 g/mol




