CAS 35681-68-6
:1H-Imidazol-5-ol, 1-methyl-4-nitro-, sodium salt (1:1)
Description:
1H-Imidazol-5-ol, 1-methyl-4-nitro-, sodium salt (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methyl group and a nitro group attached to the imidazole ring, contributing to its unique chemical properties. As a sodium salt, it is typically soluble in water, which enhances its utility in various applications, including pharmaceuticals and biochemistry. The presence of the nitro group can impart specific reactivity, making it a potential candidate for further chemical modifications or as a precursor in synthetic pathways. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its CAS number, 35681-68-6, allows for precise identification in chemical databases and literature. Overall, this compound's structural features and solubility profile make it an interesting subject for research in both organic chemistry and pharmacology.
Formula:C4H5N3O3·Na
InChI:InChI=1S/C4H5N3O3.Na/c1-6-2-5-3(4(6)8)7(9)10;/h2,8H,1H3;
InChI key:InChIKey=HBUDBUOJPSKVNQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)N(C)C=N1.[Na]
Synonyms:- 1H-Imidazol-5-ol, 1-methyl-4-nitro-, sodium salt (1:1)
- 1H-Imidazol-5-ol, 1-methyl-4-nitro-, sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Azathioprine EP Impurity E Sodium Salt
CAS:Formula:C4H4N3O3·NaColor and Shape:Light Yellow SolidMolecular weight:142.09 22.995-Hydroxy-1-methyl-4-nitroimidazole Sodium Salt (>90%)
CAS:Controlled Product<p>Impurity Azathioprine BP Impurity E<br>Stability Light Sensitive<br>Applications 5-Hydroxy-1-methyl-4-nitroimidazole Sodium Salt is a degradation product of Azathioprine (A803350); an immunosuppressive antimetabolite that is also active as a disease modifying antirheumatic drug (DMARD).<br>References Mitrou, P.S., et al.: Arzneim.-Forsch., 29, 483, 662 (1979); Ding, T.L., et al.: Drug. Metab. Dispos., 7, 373 (1979); Chan, G.L.C., et al.: Pharmacotherapy, 7, 165 (1987); Sandborn, W.J., et al.: Scand. J. Gastroenterol., 33, Suppl. 225, 92 (1998)<br></p>Formula:C4H4N3NaO3Purity:>90%Color and Shape:Light Yellow To YellowMolecular weight:165.085-Hydroxy-1-methyl-4-nitroimidazole sodium salt
CAS:Please enquire for more information about 5-Hydroxy-1-methyl-4-nitroimidazole sodium salt including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C4H4N3NaO3Purity:Min. 95%Molecular weight:165.08 g/mol
